CymitQuimica logo

CAS 458532-96-2

:

B-(2-Chloro-4-pyridinyl)boronic acid

Description:
B-(2-Chloro-4-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that has a chlorine substituent. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The chlorine atom on the pyridine ring can influence the compound's reactivity and solubility, potentially enhancing its biological activity or selectivity in chemical reactions. B-(2-Chloro-4-pyridinyl)boronic acid is often utilized in the development of pharmaceuticals, particularly in the synthesis of compounds that target specific biological pathways. Additionally, its boronic acid moiety allows for participation in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is a vital method for constructing carbon-carbon bonds in organic synthesis. Overall, this compound is significant in both research and industrial applications due to its versatile reactivity and functional properties.
Formula:C5H5BClNO2
InChI:InChI=1S/C5H5BClNO2/c7-5-3-4(6(9)10)1-2-8-5/h1-3,9-10H
InChI key:InChIKey=WJYRVVDXJMJLTN-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C=C(Cl)N=CC1
Synonyms:
  • (2-Chloro-4-pyridyl)boronic acid
  • (2-Chloropyridin-4-yl)boronic acid
  • 2-Chloro-4-pyridylboronic acid
  • B-(2-Chloro-4-pyridinyl)boronic acid
  • Boronic acid, (2-chloro-4-pyridinyl)-
  • Boronic acid, (2-chloro-4-pyridinyl)- (9CI)
  • Boronic acid, B-(2-chloro-4-pyridinyl)
  • 2-Chloropyridine-4-boronic acid
Found 7 products.