CymitQuimica logo

CAS 459-06-3

:

Benzene, 1-fluoro-4-(1-methylethoxy)-

Description:
Benzene, 1-fluoro-4-(1-methylethoxy)-, also known by its CAS number 459-06-3, is an organic compound characterized by a benzene ring substituted with a fluorine atom and an isopropoxy group. This compound features a stable aromatic structure, which contributes to its chemical stability and unique reactivity. The presence of the fluorine atom enhances its polarity and can influence its interaction with other chemical species, making it useful in various applications, including as an intermediate in organic synthesis. The isopropoxy group introduces steric hindrance, which can affect the compound's reactivity and solubility in different solvents. Generally, compounds like this may exhibit moderate volatility and can be flammable. Safety precautions are essential when handling such substances due to potential toxicity and environmental impact. Overall, the characteristics of Benzene, 1-fluoro-4-(1-methylethoxy)- make it a compound of interest in both industrial and research settings.
Formula:C9H11FO
InChI:InChI=1S/C9H11FO/c1-7(2)11-9-5-3-8(10)4-6-9/h3-7H,1-2H3
InChI key:CQNOLDRFHJLOPA-UHFFFAOYSA-N
SMILES:CC(C)OC1=CC=C(C=C1)F
Found 2 products.