CymitQuimica logo

CAS 4590-52-7

:

7-fluoro-3,4-dihydroquinolin-2(1H)-one

Description:
7-Fluoro-3,4-dihydroquinolin-2(1H)-one is a chemical compound characterized by its unique bicyclic structure, which includes a quinoline core with a fluorine substituent at the 7-position and a carbonyl group at the 2-position. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl group. The fluorine atom can influence the compound's electronic properties, potentially enhancing its biological activity or altering its interaction with other molecules. 7-Fluoro-3,4-dihydroquinolin-2(1H)-one may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can be optimized for specific biological targets. Additionally, its synthesis and characterization involve standard organic chemistry techniques, and it may serve as a precursor or intermediate in the synthesis of more complex compounds. Overall, this compound exemplifies the diverse chemistry of fluorinated heterocycles and their applications in various fields.
Formula:C9H8FNO
InChI:InChI=1/C9H8FNO/c10-7-3-1-6-2-4-9(12)11-8(6)5-7/h1,3,5H,2,4H2,(H,11,12)
InChI key:KUWDWKUKAVRBKW-UHFFFAOYSA-N
SMILES:c1cc(cc2c1CCC(=N2)O)F
Synonyms:
  • 2(1H)-Quinolinone, 7-fluoro-3,4-dihydro-
Found 6 products.