CymitQuimica logo

CAS 459157-33-6

:

4,5,6,7-Tetrahydro-3-nitropyrazolo[1,5-a]pyridine-2-carboxylic acid

Description:
4,5,6,7-Tetrahydro-3-nitropyrazolo[1,5-a]pyridine-2-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which includes a pyrazole ring fused to a pyridine ring. This compound features a nitro group and a carboxylic acid functional group, contributing to its chemical reactivity and potential biological activity. The presence of the nitro group may enhance its ability to participate in various chemical reactions, while the carboxylic acid group can engage in hydrogen bonding and influence solubility in polar solvents. The tetrahydro configuration indicates that the compound is saturated, which may affect its stability and reactivity compared to unsaturated analogs. This compound is of interest in medicinal chemistry and pharmacology, potentially serving as a lead compound for the development of new therapeutic agents. Its specific properties, such as melting point, solubility, and spectral characteristics, would typically be determined through experimental methods and may vary based on the conditions of synthesis and purification.
Formula:C8H9N3O4
InChI:InChI=1S/C8H9N3O4/c12-8(13)6-7(11(14)15)5-3-1-2-4-10(5)9-6/h1-4H2,(H,12,13)
InChI key:InChIKey=YEWUUHHCMMBICC-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2N(N=C1C(O)=O)CCCC2
Synonyms:
  • 3-Nitro-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carboxylic acid
  • Pyrazolo[1,5-a]pyridine-2-carboxylic acid, 4,5,6,7-tetrahydro-3-nitro-
  • 4,5,6,7-Tetrahydro-3-nitropyrazolo[1,5-a]pyridine-2-carboxylic acid
  • 3-Nitro-4H,5H,6H,7H-pyrazolo[1,5-a]pyridine-2-carboxylic acid
  • 3-Nitro-4,5,6,7-tetrahydro-pyrazolo[1,5-a]pyridine-2-carboxylic acid
Found 1 products.