CymitQuimica logo

CAS 4595-64-6

:

5-Bromo-4-butylpyrimidine

Description:
5-Bromo-4-butylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a bromine atom at the 5-position and a butyl group at the 4-position. This compound typically appears as a colorless to light yellow liquid or solid, depending on its form and purity. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic butyl group. The presence of the bromine atom introduces notable reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. 5-Bromo-4-butylpyrimidine is often utilized in medicinal chemistry and material science for the synthesis of biologically active compounds and functional materials. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C8H11BrN2
InChI:InChI=1/C8H11BrN2/c1-2-3-4-8-7(9)5-10-6-11-8/h5-6H,2-4H2,1H3
InChI key:LLPITUMEHNOXPJ-UHFFFAOYSA-N
SMILES:CCCCc1c(cncn1)Br
Synonyms:
  • Pyrimidine, 5-Bromo-4-Butyl-
  • 5-Bromo-4-butylpyrimidine
Found 2 products.