CymitQuimica logo

CAS 460345-16-8

:

1-hexyl-3-methyl-1H-imidazol-3-ium trifluoromethanesulfonate

Description:
1-Hexyl-3-methyl-1H-imidazol-3-ium trifluoromethanesulfonate, with CAS number 460345-16-8, is an ionic liquid characterized by its unique structure and properties. It features a 1-hexyl-3-methylimidazolium cation, which contributes to its hydrophobic nature due to the long hexyl chain, while the trifluoromethanesulfonate anion enhances its ionic characteristics. This compound is typically colorless to pale yellow and exhibits low volatility, making it stable at room temperature. Its ionic nature imparts high thermal stability and a wide liquid range, which are advantageous for various applications. Additionally, it is known for its excellent solvation properties, making it suitable as a solvent in organic synthesis and electrochemical applications. The trifluoromethanesulfonate anion also provides strong acidity, which can influence reactivity in chemical processes. Overall, this compound is of interest in fields such as green chemistry, catalysis, and materials science due to its unique properties and potential applications.
Formula:C11H19F3N2O3S
InChI:InChI=1/C10H19N2.CHF3O3S/c1-3-4-5-6-7-12-9-8-11(2)10-12;2-1(3,4)8(5,6)7/h8-10H,3-7H2,1-2H3;(H,5,6,7)/q+1;/p-1
InChI key:RABFGPMWVQNDHI-UHFFFAOYSA-M
SMILES:CCCCCCN1C=C[N+](=C1)C.C(F)(F)(F)S(=O)(=O)[O-]
Synonyms:
  • 1-Hexyl-3-Methylimidazolium Trifluoromethanesulfonate
Found 5 products.