CymitQuimica logo

CAS 461432-22-4

:

(5-Bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone

Description:
(5-Bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone, with the CAS number 461432-22-4, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with both bromine and chlorine atoms, as well as an ethoxy group. This compound typically exhibits properties associated with aromatic ketones, such as moderate solubility in organic solvents and potential reactivity in electrophilic substitution reactions due to the presence of halogen substituents. The bromine and chlorine atoms can influence the compound's electronic properties, potentially enhancing its reactivity and making it useful in various synthetic applications. Additionally, the ethoxy group may contribute to the compound's solubility and steric effects, impacting its interactions in chemical reactions. Overall, this compound may be of interest in medicinal chemistry and materials science, where its unique substituents can be leveraged for specific applications or biological activities.
Formula:C15H12BrClO2
InChI:InChI=1S/C15H12BrClO2/c1-2-19-12-6-3-10(4-7-12)15(18)13-9-11(16)5-8-14(13)17/h3-9H,2H2,1H3
InChI key:InChIKey=OEURLNJEQCLGPS-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Cl)C=CC(Br)=C1)C2=CC=C(OCC)C=C2
Synonyms:
  • (2-Chloro-5-bromophenyl)(4-ethoxyphenyl)methanone
  • (5-Brom-2-chlorphenyl)(4-ethoxyphenyl)methanon
  • 5-Bromo-2-Chloro-4'-Ethoxybenzophenone
  • Methanone, (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)-
  • (5-Bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone
Found 8 products.