CymitQuimica logo

CAS 4617-33-8

:

15-Hydroxypentadecanoic acid

Description:
15-Hydroxypentadecanoic acid, with the CAS number 4617-33-8, is a long-chain fatty acid characterized by the presence of a hydroxyl group at the 15th carbon of the pentadecanoic acid chain. This compound is part of the family of hydroxy fatty acids, which are known for their unique properties and potential biological activities. It typically appears as a white to off-white solid or waxy substance and is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The hydroxyl group contributes to its reactivity, allowing for various chemical modifications and potential applications in the synthesis of surfactants, emulsifiers, and other specialty chemicals. Additionally, hydroxy fatty acids like 15-hydroxypentadecanoic acid may exhibit antimicrobial and anti-inflammatory properties, making them of interest in pharmaceutical and cosmetic formulations. Its structural characteristics and functional groups also suggest potential roles in biochemistry and nutrition, particularly in relation to lipid metabolism and cellular signaling pathways.
Formula:C15H30O3
InChI:InChI=1S/C15H30O3/c16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15(17)18/h16H,1-14H2,(H,17,18)
InChI key:InChIKey=BZUNJUAMQZRJIP-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCO)CCCCC(O)=O
Synonyms:
  • 14-Hydroxy-1-tetradecanecarboxylic acid
  • 15-Hydroxypentadecanoate
  • Pentadecanoic acid, 15-hydroxy-
  • ω-Hydroxypentadecanoic acid
  • 15-Hydroxypentadecanoic acid
Found 10 products.