CymitQuimica logo

CAS 462068-15-1

:

1,3-Dioxolo[4,5-g]quinoline-7-carboxaldehyde, 5,6-dihydro-6-oxo-

Description:
1,3-Dioxolo[4,5-g]quinoline-7-carboxaldehyde, 5,6-dihydro-6-oxo- is a heterocyclic organic compound characterized by its fused dioxole and quinoline structures. This compound features a carboxaldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 5,6-dihydro-6-oxo moiety indicates that it has a saturated ring system, which can influence its chemical properties, such as stability and reactivity. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features allow for various interactions with biological targets, potentially leading to therapeutic applications. Additionally, the compound's properties, such as solubility, melting point, and spectral characteristics, would be essential for understanding its behavior in different environments and applications. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry, with potential implications in various scientific and industrial applications.
Formula:C11H7NO4
InChI:InChI=1S/C11H7NO4/c13-4-7-1-6-2-9-10(16-5-15-9)3-8(6)12-11(7)14/h1-4H,5H2,(H,12,14)
InChI key:JHECNOLILDQPIP-UHFFFAOYSA-N
SMILES:C1OC2=C(O1)C=C3C(=C2)C=C(C(=O)N3)C=O
Synonyms:
  • IFLAB-BB F1938-0007
  • 1,3-Dioxolo[4,5-g]quinoline-7-carboxaldehyde, 5,6-dihydro-6-oxo-
  • AKOS BBS-00005355
  • 6-OXO-5,6-DIHYDRO-[1,3]DIOXOLO[4,5-G]QUINOLINE-7-CARBALDEHYDE
Found 4 products.