CAS 465-11-2
:Gamabufotalin
Description:
Gamabufotalin, with the CAS number 465-11-2, is a naturally occurring compound classified as a bufadienolide, which is a type of steroidal glycoside. It is primarily derived from the skin and glands of certain toads, particularly those in the Bufo genus. This compound exhibits a range of biological activities, including cardiotonic effects, which can influence heart muscle contractions. Gamabufotalin has garnered interest in pharmacological research due to its potential anti-cancer properties, as it has been shown to induce apoptosis in various cancer cell lines. Additionally, it possesses antimicrobial and anti-inflammatory effects, making it a subject of study for various therapeutic applications. However, its use is complicated by potential toxicity, as bufadienolides can have significant effects on the cardiovascular system. As with many natural compounds, further research is necessary to fully understand its mechanisms of action, therapeutic potential, and safety profile.
Formula:C24H34O5
InChI:InChI=1S/C24H34O5/c1-22-9-7-16(25)11-15(22)4-5-18-21(22)19(26)12-23(2)17(8-10-24(18,23)28)14-3-6-20(27)29-13-14/h3,6,13,15-19,21,25-26,28H,4-5,7-12H2,1-2H3/t15-,16+,17-,18-,19-,21-,22+,23-,24+/m1/s1
InChI key:InChIKey=FMTLOAVOGWSPEF-KJRPADTMSA-N
SMILES:C[C@@]12[C@@](O)([C@]3([C@]([C@H](O)C1)([C@]4(C)[C@](CC3)(C[C@@H](O)CC4)[H])[H])[H])CC[C@@H]2C=5C=CC(=O)OC5
Synonyms:- (3Beta,5Beta,11Alpha)-3,11,14-Trihydroxybufa-20,22-Dienolide
- (3Beta,5Beta,8Xi,9Xi,11Alpha)-3,11,14-Trihydroxybufa-20,22-Dienolide
- (3β,5β,11α)-3,11,14-Trihydroxybufa-20,22-dienolide
- 5β-Bufa-20,22-dienolide, 3β,11α,14-trihydroxy-
- Bufa-20,22-dienolide, 3,11,14-trihydroxy-, (3β,5β,11α)-
- Gamabufagin
- Gamabufogenin
- Gamabufotalin
- Gammabufotalin
- NSC 90384
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(3β,5β,11α)-3,11,14-Trihydroxybufa-20,22-dienolide
CAS:Formula:C24H34O5Purity:98%Color and Shape:SolidMolecular weight:402.5238Gamabufotalin
CAS:Gamabufotalin(CS-6), a bufadienolide compound from toad venom, suppresses COX-2 expression through targeting IKKβ/NF-κB signaling pathway in lung cancer cells, suggests that CS-6 exhibits potential use in the treatment of COX-2-mediated diseases such as lung cancer.Formula:C24H34O5Purity:95%~99%Color and Shape:PowderMolecular weight:402.531Gamabufotalin
CAS:Gamabufotalin, a Chansu bufadienolide, treats COX-2 diseases and cancer with high stability and low side effects.Formula:C24H34O5Purity:99.18% - 99.51%Color and Shape:SolidMolecular weight:402.52Ref: TM-T4A2456
1mg84.00€1mL*10mM (DMSO)119.00€5mg178.00€10mg295.00€25mg497.00€50mg708.00€100mg964.00€Gamabufotalin
CAS:Gamabufotalin is a cardiotonic bufadienolide, which is a type of steroid compound. It is derived from the secretions of toads belonging to the Bufo genus, particularly the parotoid gland secretions. The mode of action of Gamabufotalin involves inhibition of the Na+/K+-ATPase pump, leading to an increase in intracellular calcium levels, which facilitates increased cardiac contractility. Additionally, this compound has been found to induce apoptosis in cancer cells through pathways such as the regulation of Bcl-2 family proteins and the activation of caspases.Purity:Min. 95%





