CAS 465-21-4: Bufalin
Description:Bufalin is a potent cardiac glycoside derived from the skin of toads, particularly the Bufo species. It is classified under the broader category of bufadienolides, which are known for their ability to inhibit the Na+/K+ ATPase enzyme, leading to increased intracellular calcium levels and enhanced cardiac contractility. Bufalin exhibits a variety of biological activities, including anti-tumor, anti-inflammatory, and anti-viral properties, making it a subject of interest in pharmacological research. The compound is typically characterized by its steroid-like structure, featuring a lactone ring and multiple hydroxyl groups, which contribute to its biological activity. Bufalin is lipophilic, allowing it to easily cross cell membranes, and it has been studied for its potential therapeutic applications, particularly in the treatment of certain cancers and heart conditions. However, its use is limited by its toxicity and potential side effects, necessitating careful consideration in clinical settings. Overall, bufalin represents a fascinating example of a natural product with significant pharmacological potential.
Formula:C24H34O4
InChI:InChI=1S/C24H34O4/c1-22-10-7-17(25)13-16(22)4-5-20-19(22)8-11-23(2)18(9-12-24(20,23)27)15-3-6-21(26)28-14-15/h3,6,14,16-20,25,27H,4-5,7-13H2,1-2H3/t16-,17+,18-,19+,20-,22+,23-,24+/m1/s1
InChI key:InChIKey=QEEBRPGZBVVINN-BMPKRDENSA-N
SMILES:O=C1OC=C(C=C1)C2CCC3(O)C4CCC5CC(O)CCC5(C)C4CCC23C
- Synonyms:
- (3Beta,5Beta,8Xi,9Xi)-3,14-Dihydroxybufa-20,22-Dienolide
- (3β,5β)-3,14-Dihydroxybufa-20,22-dienolide
- 3,14-Dihydroxybufa-20,22-Dienolide
- 5β-Bufa-20,22-dienolide, 3β,14-dihydroxy-
- B 0261
- Bufa-20,22-dienolide, 3,14-dihydroxy-, (3β,5β)-
- NSC 89595
- Bufalin
