CAS 465-92-9
:Marrubiin
Description:
Marrubiin is a naturally occurring sesquiterpene lactone, primarily extracted from the plant species Marrubium vulgare, commonly known as white horehound. It is characterized by its complex bicyclic structure, which contributes to its diverse biological activities. Marrubiin exhibits a range of pharmacological properties, including anti-inflammatory, antimicrobial, and antioxidant effects, making it of interest in both traditional medicine and modern pharmacology. The compound is typically found in the form of a white to pale yellow crystalline solid and is soluble in organic solvents but has limited solubility in water. Its chemical formula reflects a specific arrangement of carbon, hydrogen, and oxygen atoms, which is crucial for its biological activity. Research has indicated that marrubiin may influence various physiological processes, including modulation of immune responses and potential anticancer effects. However, further studies are necessary to fully elucidate its mechanisms of action and therapeutic potential. As with many natural compounds, the extraction and purification processes can affect its efficacy and stability.
Formula:C20H28O4
InChI:InChI=1S/C20H28O4/c1-13-11-15-16-18(2,17(21)24-15)7-4-8-19(16,3)20(13,22)9-5-14-6-10-23-12-14/h6,10,12-13,15-16,22H,4-5,7-9,11H2,1-3H3/t13-,15-,16+,18+,19+,20-/m1/s1
InChI key:InChIKey=HQLLRHCTVDVUJB-OBHOOXMTSA-N
SMILES:C[C@@]12[C@]3([C@](OC(=O)[C@@]3(C)CCC1)(C[C@@H](C)[C@@]2(CCC=4C=COC4)O)[H])[H]
Synonyms:- (2aS,5aS,6R,7R,8aR,8bR)-6-[2-(3-Furanyl)ethyl]decahydro-6-hydroxy-2a,5a,7-trimethyl-2H-naphtho[1,8-bc]furan-2-one
- (2aS,5aS,6R,7R,8aR,8bR)-6-[2-(furan-3-yl)ethyl]-6-hydroxy-2a,5a,7-trimethyldecahydro-2H-naphtho[1,8-bc]furan-2-one
- 15,16-Epoxy-6β,9-dihydroxy-8β<span class="text-smallcaps">H</span>-labda-13(16),14-dien-19-oic acid γ-lactone
- 2H-Naphtho[1,8-bc]furan-2-one, 6-[2-(3-furanyl)ethyl]decahydro-6-hydroxy-2a,5a,7-trimethyl-, (2aS,5aS,6R,7R,8aR,8bR)-
- 2H-Naphtho[1,8-bc]furan-2-one, 6-[2-(3-furanyl)ethyl]decahydro-6-hydroxy-2a,5a,7-trimethyl-, [2aS-(2aα,5aβ,6α,7α,8aα,8bα)]-
- 6-[2-(furan-3-yl)ethyl]-6-hydroxy-2a,5a,7-trimethyldecahydro-2H-naphtho[1,8-bc]furan-2-one
- 8β<span class="text-smallcaps">H</span>-Labda-13(16),14-dien-19-oic acid, 15,16-epoxy-6β,9-dihydroxy-, γ-lactone
- Marrubiin
- Marrubin
- NSC 36693
- 8βH-Labda-13(16),14-dien-19-oic acid, 15,16-epoxy-6β,9-dihydroxy-, γ-lactone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Marrubiin
CAS:Marrubiin analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C20H28O4Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:332.44Marrubiin
CAS:Formula:C20H28O4Purity:≥ 95.0%Color and Shape:White to yellow powderMolecular weight:332.43Marrubiin
CAS:Marrubiin is a natural productFormula:C20H28O4Purity:99.81%Color and Shape:White SolidMolecular weight:332.43Marrubiin
CAS:LactoneFormula:C20H28O4Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:332.44Marrubiin
CAS:Marrubiin is a plant-derived alkaloid, which is extracted from the white horehound (Marrubium vulgare) plant. This diterpenoid compound acts primarily through its ability to stimulate gastric secretion, which in turn influences the respiratory system by increasing the production of fluid mucus. This action facilitates the expectoration of phlegm, making Marrubiin useful in treating conditions that involve excessive mucus buildup in the airways, such as chronic bronchitis and asthma.Formula:C20H28O4Purity:Min. 95%Color and Shape:PowderMolecular weight:332.43 g/mol








