CymitQuimica logo

CAS 465514-21-0

:

4-[(1,1-dioxo-1lambda~6~,4-thiazinan-4-yl)methyl]benzoic acid

Description:
4-[(1,1-Dioxo-1λ6,4-thiazinan-4-yl)methyl]benzoic acid, identified by its CAS number 465514-21-0, is a chemical compound that features a thiazine ring, which is characterized by a sulfur atom and nitrogen atom in its structure. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds due to the presence of the benzoic acid moiety and the thiazine ring. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or as a biochemical reagent, given its structural complexity. The presence of the dioxo group suggests it may participate in various chemical reactions, including redox processes. Additionally, the carboxylic acid functional group can engage in hydrogen bonding, influencing its solubility and reactivity in different solvents. Overall, this compound's unique structure may confer specific biological activities or interactions, making it of interest in medicinal chemistry and related fields.
Formula:C12H15NO4S
InChI:InChI=1/C12H15NO4S/c14-12(15)11-3-1-10(2-4-11)9-13-5-7-18(16,17)8-6-13/h1-4H,5-9H2,(H,14,15)
InChI key:HMVAVIKQXATKEL-UHFFFAOYSA-N
SMILES:c1cc(ccc1CN1CCS(=O)(=O)CC1)C(=O)O
Synonyms:
  • 4-[(1,1-Dioxidothiomorpholin-4-Yl)Methyl]Benzoic Acid
Found 2 products.