CymitQuimica logo

CAS 4670-10-4

:

(3,5-Dimethoxyphenyl)acetic acid

Description:
(3,5-Dimethoxyphenyl)acetic acid, with the CAS number 4670-10-4, is an organic compound characterized by its aromatic structure and the presence of two methoxy groups attached to a phenyl ring. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The methoxy groups enhance the compound's lipophilicity and can influence its reactivity and interaction with biological systems. Typically, compounds like (3,5-Dimethoxyphenyl)acetic acid are studied for their potential pharmacological activities, including anti-inflammatory and analgesic effects. The presence of the methoxy substituents can also affect the compound's solubility and stability in various solvents. In terms of physical properties, it is likely to be a solid at room temperature, with a specific melting point and boiling point that would depend on its molecular weight and structure. Overall, (3,5-Dimethoxyphenyl)acetic acid is of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.
Formula:C10H12O4
InChI:InChI=1S/C10H12O4/c1-13-8-3-7(5-10(11)12)4-9(6-8)14-2/h3-4,6H,5H2,1-2H3,(H,11,12)
InChI key:InChIKey=FFPAFDDLAGTGPQ-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=CC(OC)=CC(OC)=C1
Synonyms:
  • (3,5-Dimethoxyphenyl)Acetate
  • (3,5-Dimethoxyphenyl)acetic acid
  • 2-(3,5-Dimethoxyphenyl)acetic acid
  • 3,5-Dimethoxybenzeneacetic acid
  • Acetic acid, (3,5-dimethoxyphenyl)-
  • Benzeneacetic acid, 3,5-dimethoxy-
Found 7 products.