CymitQuimica logo

CAS 467235-83-2

:

Hexadecanoic-d31 acid,sodium salt (9CI)

Description:
Hexadecanoic-d31 acid, sodium salt (9CI), also known as sodium palmitate-d31, is a deuterated form of palmitic acid, a saturated fatty acid with a long carbon chain. This compound features a 16-carbon backbone with a carboxylate group, and the "d31" designation indicates that 31 hydrogen atoms in the molecule have been replaced with deuterium, a stable isotope of hydrogen. This substitution enhances its utility in various analytical techniques, particularly in nuclear magnetic resonance (NMR) spectroscopy, where it aids in the study of molecular dynamics and interactions. As a sodium salt, it is typically more soluble in water compared to its acid form, making it useful in various applications, including as an emulsifier or surfactant in food and cosmetic formulations. Additionally, its deuterated nature allows for precise tracking in metabolic studies and other research applications. Overall, Hexadecanoic-d31 acid, sodium salt, is valued for its unique isotopic labeling, which provides insights into biochemical processes.
Formula:C16HD31O2・Na
InChI:InChI=1S/C16H32O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h2-15H2,1H3,(H,17,18);/q;+1/p-1/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D2,15D2;
InChI key:GGXKEBACDBNFAF-HXKBIXQXSA-M
SMILES:[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)[O-].[Na+]
Synonyms:
  • Sodium Hexadecanoate-D31
Found 5 products.