CymitQuimica logo

CAS 468068-58-8

:

2-Chloro-N-hydroxy-3-pyridinecarboximidamide

Description:
2-Chloro-N-hydroxy-3-pyridinecarboximidamide, with the CAS number 468068-58-8, is a chemical compound characterized by its unique functional groups and structural features. It contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, contributing to its basicity and potential for hydrogen bonding. The presence of a chloro group introduces reactivity, making it a potential electrophile in various chemical reactions. The N-hydroxy group enhances its solubility in polar solvents and may participate in hydrogen bonding, influencing its biological activity. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. Its specific properties, such as melting point, boiling point, and solubility, can vary based on the purity and form of the compound. Overall, 2-Chloro-N-hydroxy-3-pyridinecarboximidamide represents a class of compounds that may exhibit interesting pharmacological properties, warranting further investigation in drug discovery and development.
Formula:C6H6ClN3O
InChI:InChI=1S/C6H6ClN3O/c7-5-4(6(8)10-11)2-1-3-9-5/h1-3,11H,(H2,8,10)
InChI key:InChIKey=PMCUAFXCQFZXSH-UHFFFAOYSA-N
SMILES:C(NO)(=N)C1=C(Cl)N=CC=C1
Synonyms:
  • 2-Chloro-N-hydroxy-3-pyridinecarboximidamide
  • 2-Chloro-N-hydroxynicotinamidine
  • 3-pyridinecarboximidamide, 2-chloro-N'-hydroxy-
  • 468068-58-8
  • 2-Chloro-N′-hydroxypyridine-3-carboximidamide
Found 3 products.