CAS 4692-98-2
:5-bromoisatoic anhydride
Description:
5-Bromoisatoic anhydride is an organic compound characterized by its anhydride functional group, which is derived from isatoic acid. It features a bromine atom at the 5-position of the isatoic acid structure, contributing to its reactivity and potential applications in organic synthesis. The compound typically appears as a solid and is known for its ability to undergo hydrolysis to form the corresponding isatoic acid upon exposure to moisture. Its reactivity is primarily attributed to the anhydride group, which can participate in acylation reactions, making it useful in the synthesis of various derivatives and intermediates in pharmaceuticals and agrochemicals. Additionally, the presence of the bromine atom can enhance electrophilic substitution reactions, allowing for further functionalization. Safety precautions should be observed when handling this compound, as it may pose health risks through inhalation or skin contact. Overall, 5-bromoisatoic anhydride is a valuable reagent in synthetic organic chemistry, particularly in the development of complex molecular architectures.
Formula:C17H15Cl2NO
InChI:InChI=1/C17H15Cl2NO/c18-14-9-8-13(15(19)10-14)11-20-16-6-2-1-4-12(16)5-3-7-17(20)21/h1-2,4,6,8-10H,3,5,7,11H2
SMILES:c1ccc2c(c1)CCCC(=O)N2Cc1ccc(cc1Cl)Cl
Synonyms:- 6-bromo-2H-3,1-benzoxazine-2,4(1H)-dione
- 1-(2,4-dichlorobenzyl)-1,3,4,5-tetrahydro-2H-1-benzazepin-2-one
- 5-Bromoisoatoic anhydride
- 6-Bromo-1H-Benzo[D][1,3]Oxazine-2,4-Dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2H-3,1-Benzoxazine-2,4(1H)-dione, 6-bromo-
CAS:Formula:C8H4BrNO3Purity:95%Color and Shape:SolidMolecular weight:242.02635-Bromoisatoic anhydride
CAS:5-Bromoisatoic anhydrideFormula:C8H4BrNO3Purity:98%Color and Shape:Tan Solid-PowderMolecular weight:242.026265-Bromoisatoic anhydride
CAS:Formula:C8H4BrNO3Purity:90%Color and Shape:Solid, Off-white solidMolecular weight:242.0285-Bromoisatoic Anhydride
CAS:Formula:C8H4BrNO3Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:242.035-Bromoisatoic anhydride
CAS:5-Bromoisatoic anhydride is an antibiotic that inhibits the enzyme ido1, which is involved in the synthesis of amines. This chemical has been shown to have inhibitory activity against cancer cells and potential antitumor properties. 5-Bromoisatoic anhydride has also been shown to have antimicrobial properties. It binds to bacterial ribosomes, inhibiting protein synthesis and leading to cell death by inhibiting the production of proteins vital for cell division. 5-Bromoisatoic anhydride has been shown to be active against staphylococcus aureus, Escherichia coli, and Pseudomonas aeruginosa isolates. The compound also shows inhibitory activities against Flavus assays and human colon carcinoma HCT116 cells.Formula:C8H4BrNO3Purity:Min. 95%Color and Shape:White PowderMolecular weight:242.03 g/mol




