CymitQuimica logo

CAS 4705-52-6

:

tetrahydroimidazo[1,5-a]pyridine-1,3(2H,5H)-dione

Description:
Tetrahydroimidazo[1,5-a]pyridine-1,3(2H,5H)-dione, with the CAS number 4705-52-6, is a heterocyclic organic compound characterized by its bicyclic structure that incorporates both imidazole and pyridine functionalities. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. Its molecular structure features a fused ring system that contributes to its unique chemical properties, including potential biological activity. Tetrahydroimidazo[1,5-a]pyridine-1,3(2H,5H)-dione may participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions, due to the presence of reactive functional groups. It has garnered interest in medicinal chemistry for its potential applications in drug development, particularly in the fields of neuropharmacology and anti-inflammatory research. The compound's stability, reactivity, and solubility characteristics make it a subject of study for various synthetic and therapeutic applications. As with many chemical substances, proper handling and safety precautions are essential when working with this compound in laboratory settings.
Formula:C7H10N2O2
InChI:InChI=1/C7H10N2O2/c10-6-5-3-1-2-4-9(5)7(11)8-6/h5H,1-4H2,(H,8,10,11)
SMILES:C1CCN2C(C1)C(=NC2=O)O
Synonyms:
  • Imidazo[1,5-a]pyridine-1,3(2H,5H)-dione, tetrahydro-
  • Tetrahydroimidazo[1,5-a]pyridine-1,3(2H,5H)-dione
Found 1 products.