CAS 4706-17-6
:Tris(hydroxypropyl)phosphine
Description:
Tris(hydroxypropyl)phosphine, with the CAS number 4706-17-6, is a phosphine derivative characterized by the presence of three hydroxypropyl groups attached to a phosphorus atom. This compound is typically a colorless to pale yellow liquid and is known for its solubility in water and organic solvents, which makes it versatile in various applications. It exhibits properties such as being a reducing agent and a stabilizer, often utilized in organic synthesis and as a ligand in coordination chemistry. The hydroxypropyl groups contribute to its hydrophilicity and enhance its reactivity, allowing it to participate in various chemical reactions, including those involving nucleophilic attack. Additionally, tris(hydroxypropyl)phosphine can form complexes with metals, making it useful in catalysis and materials science. Safety data indicates that, while it is generally considered to have low toxicity, appropriate handling and safety measures should be observed due to its chemical nature. Overall, tris(hydroxypropyl)phosphine is a valuable compound in both industrial and research settings.
Formula:C9H21O3P
InChI:InChI=1S/C9H21O3P/c10-4-1-7-13(8-2-5-11)9-3-6-12/h10-12H,1-9H2
InChI key:YICAEXQYKBMDNH-UHFFFAOYSA-N
SMILES:C(CO)CP(CCCO)CCCO
Synonyms:- Tris(3-hydroxypropyl)phosphine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Tris(hydroxypropyl)phosphine (ca. 40 wt% in Water)
CAS:Formula:C9H21O3PColor and Shape:Colorless to Light yellow clear liquidMolecular weight:208.24Tris(3-hydroxypropyl)phosphine, min. 84%
CAS:Tris(3-hydroxypropyl)phosphine, min. 80%
Formula:(HOC3H6)3PPurity:min. 84%Color and Shape:viscous liq.Molecular weight:208.24THPP
CAS:THPP (Tris(3-hydroxypropyl)phosphine) is a synthetic intermediate.Formula:C9H21O3PPurity:99.87%Color and Shape:SolidMolecular weight:208.24Tris(hydroxypropyl)phosphine
CAS:Tris(hydroxypropyl)phosphineFormula:C9H21O3PPurity:80%Molecular weight:208.24Tris(hydroxypropyl) phosphine
CAS:Tris(hydroxypropyl)phosphine (THPP) is a water-soluble phosphine based disulfide reducing agent. THPP has similar properties to TCEP-HC: it is faster than the commonly used DTT and DTE, is stable to oxygen and metals, appears as a non-volatile odourless solid and can be used at a broad pH range. An advantage over TCEP-HCl is the fact that THPP can be used in buffered aqueous-organic media and is more stable to air oxidation.Formula:C9H21O3PPurity:(Titration) Min. 80.0%Molecular weight:208.24 g/mol







