CymitQuimica logo

CAS 4706-17-6

:

Tris(hydroxypropyl)phosphine

Description:
Tris(hydroxypropyl)phosphine, with the CAS number 4706-17-6, is a phosphine derivative characterized by the presence of three hydroxypropyl groups attached to a phosphorus atom. This compound is typically a colorless to pale yellow liquid and is known for its solubility in water and organic solvents, which makes it versatile in various applications. It exhibits properties such as being a reducing agent and a stabilizer, often utilized in organic synthesis and as a ligand in coordination chemistry. The hydroxypropyl groups contribute to its hydrophilicity and enhance its reactivity, allowing it to participate in various chemical reactions, including those involving nucleophilic attack. Additionally, tris(hydroxypropyl)phosphine can form complexes with metals, making it useful in catalysis and materials science. Safety data indicates that, while it is generally considered to have low toxicity, appropriate handling and safety measures should be observed due to its chemical nature. Overall, tris(hydroxypropyl)phosphine is a valuable compound in both industrial and research settings.
Formula:C9H21O3P
InChI:InChI=1S/C9H21O3P/c10-4-1-7-13(8-2-5-11)9-3-6-12/h10-12H,1-9H2
InChI key:YICAEXQYKBMDNH-UHFFFAOYSA-N
SMILES:C(CO)CP(CCCO)CCCO
Synonyms:
  • Tris(3-hydroxypropyl)phosphine
Found 8 products.