CAS 4707-56-6
:[2-(dimethylamino)phenyl]methanol
Description:
[2-(Dimethylamino)phenyl]methanol, with the CAS number 4707-56-6, is an organic compound characterized by the presence of a phenolic structure substituted with a dimethylamino group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its role as an intermediate in organic synthesis and may exhibit properties such as solubility in polar solvents due to the hydroxyl group, while the dimethylamino group can influence its basicity and reactivity. The compound may also display biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with various biological targets, which can be explored in pharmacological studies. Safety data should be consulted, as compounds with amine functionalities can sometimes pose risks such as irritation or toxicity. Overall, [2-(dimethylamino)phenyl]methanol serves as a valuable building block in chemical research and development.
Formula:C9H13NO
InChI:InChI=1/C9H13NO/c1-10(2)9-6-4-3-5-8(9)7-11/h3-6,11H,7H2,1-2H3
SMILES:CN(C)c1ccccc1CO
Synonyms:- Benzenemethanol, 2-(Dimethylamino)-
- Benzyl alcohol, o-(dimethylamino)-
- Dimethylaminobenzyl alcohol
- [2-(Dimethylamino)phenyl]methanol
- [2-(DIMETHYLAMINO)PHENYL]METHANOL(WXG00473)
- NISTC4707566
- 2-(Dimethylamino)benzyl alcohol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(Dimethylamino)benzyl alcohol
CAS:2-(Dimethylamino)benzyl alcoholFormula:C9H13NOPurity:≥95%Molecular weight:151.20562[2-(dimethylamino)phenyl]methanol
CAS:2-(dimethylamino)phenylmethanol is a chemical that belongs to the class of aromatic compounds. It is used in organic synthesis to form nitro and zinc chloride, which are reagents for the synthesis of aminobenzyl (2-aminobenzyl alcohol). When 2-(dimethylamino)phenylmethanol reacts with potassium borohydride, it yields an amido group. This reaction is also known as the "Buchwald-Hartwig reaction." 2-(dimethylamino)phenylmethanol is also used in organic syntheses to form monoalkyl chlorides, which are useful for the preparation of anthranilic acid and tetrahydrofuran.Formula:C9H13NOPurity:Min. 95%Molecular weight:151.2 g/mol



