CAS 471-53-4

Glycyrrhetinic acid

Description:

Glycyrrhetinic acid is a triterpenoid compound derived from the root of the licorice plant, Glycyrrhiza glabra. It is known for its sweet flavor and is often used in traditional medicine for its anti-inflammatory, antiviral, and hepatoprotective properties. The chemical structure of glycyrrhetinic acid features a pentacyclic triterpene framework, which contributes to its biological activity. It is typically found as a white to off-white crystalline powder and is soluble in organic solvents like ethanol and methanol, but has limited solubility in water. Glycyrrhetinic acid is recognized for its ability to inhibit the enzyme 11β-hydroxysteroid dehydrogenase type 2, which can lead to increased cortisol levels in the body. This property has implications for its use in treating conditions related to adrenal insufficiency and other hormonal imbalances. Additionally, it has been studied for its potential effects on skin health and its role in modulating immune responses. However, excessive consumption can lead to side effects, including hypertension and hypokalemia, due to its mineralocorticoid-like effects.

Formula:C₃₀H₄₆O₄

InChI:InChI=1S/C30H46O4/c1-25(2)21-8-11-30(7)23(28(21,5)10-9-22(25)32)20(31)16-18-19-17-27(4,24(33)34)13-12-26(19,3)14-15-29(18,30)6/h16,19,21-23,32H,8-15,17H2,1-7H3,(H,33,34)/t19-,21-,22-,23+,26+,27-,28-,29+,30+/m0/s1

InChI key:InChIKey=MPDGHEJMBKOTSU-YKLVYJNSSA-N

SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)[C@@H](O)CC3)[H])(C(=O)C=C4[C@@]2(C)CC[C@]5(C)[C@]4(C[C@](C(O)=O)(C)CC5)[H])[H]

Synonyms: