CAS 4711-00-6
:1-[(2,2,7,7-tetramethyltetrahydro-3aH-bis[1,3]dioxolo[4,5-b:4',5'-d]pyran-5-yl)methyl]triaza-1,2-dien-2-ium (non-preferred name)
Description:
1-[(2,2,7,7-tetramethyltetrahydro-3aH-bis[1,3]dioxolo[4,5-b:4',5'-d]pyran-5-yl)methyl]triaza-1,2-dien-2-ium, with the CAS number 4711-00-6, is a complex organic compound characterized by its unique structural features, including multiple dioxole rings and a triaza-dienium framework. This compound exhibits a high degree of molecular symmetry and is likely to possess interesting electronic properties due to the presence of the triaza moiety, which can influence its reactivity and stability. The presence of the tetramethyl groups suggests enhanced steric hindrance, potentially affecting its solubility and interaction with other molecules. Additionally, the dioxole units may contribute to its potential as a ligand in coordination chemistry or as a precursor in organic synthesis. While specific applications or biological activities may not be widely documented, the structural complexity indicates potential utility in advanced materials or pharmaceuticals. Further studies would be necessary to elucidate its full range of properties and applications.
Formula:C12H20N3O5
InChI:InChI=1/C12H20N3O5/c1-11(2)17-7-6(5-14-15-13)16-10-9(8(7)18-11)19-12(3,4)20-10/h6-10,13H,5H2,1-4H3/q+1
SMILES:CC1(C)OC2C(CNN=N)OC3C(C2O1)OC(C)(C)O3
Synonyms:- 1-[(2,2,7,7-Tetramethyltetrahydro-3aH-bis[1,3]dioxolo[4,5-b:4',5'-d]pyran-5-yl)methyl]-1,2-triazadien-2-ium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,2:3,4-Di-O-isopropylidene-6-deoxy-6-azido-α-D-galactopyranose
CAS:Controlled ProductApplications 1,2:3,4-Di-O-isopropylidene-6-deoxy-6-azido-α-D-galactopyranose (cas# 4711-00-6) is a compound useful in organic synthesis.
Formula:C12H19N3O5Color and Shape:Colourless To Light YellowMolecular weight:285.36-Azido-6-deoxy-1,2:3,4-di-O-isopropylidene-a-D-galactopyranose
CAS:6-Azido-6-deoxy-1,2:3,4-di-O-isopropylidene-a-D-galactopyranose is a copper complex that is soluble in water. It is used as an initiator for the polymerization of galactose monomers. 6AIDOGAL reacts with azide or diazo compounds to form a cycloaddition reaction and can be used to prepare copolymers by reacting with other monomers such as D-glucose. The temperature range for this reaction is between 20°C and 100°C. This compound has been shown to form stable complexes with Cu(II) ions at temperatures below 0°C.Formula:C12H19N3O5Purity:Min. 98 Area-%Color and Shape:Colorless Clear LiquidMolecular weight:285.3 g/mol


