CymitQuimica logo

CAS 4720-71-2

:

acetic acid; 1,3-benzodioxole-5-carboxamidine

Description:
Acetic acid; 1,3-benzodioxole-5-carboxamidine, with the CAS number 4720-71-2, is a chemical compound that features both acetic acid and a benzodioxole moiety. This compound typically exhibits characteristics associated with both functional groups. Acetic acid contributes to its acidic properties, making it soluble in water and capable of participating in various chemical reactions, such as esterification and amidation. The presence of the 1,3-benzodioxole structure may impart unique electronic and steric properties, potentially influencing its reactivity and interactions with biological systems. This compound may also exhibit biological activity, which could be of interest in pharmaceutical applications. Its molecular structure suggests potential for hydrogen bonding, which can affect its solubility and interaction with other molecules. Overall, the combination of these functional groups in acetic acid; 1,3-benzodioxole-5-carboxamidine suggests a versatile compound with applications in organic synthesis and possibly in medicinal chemistry.
Formula:C10H12N2O4
InChI:InChI=1/C8H8N2O2.C2H4O2/c9-8(10)5-1-2-6-7(3-5)12-4-11-6;1-2(3)4/h1-3H,4H2,(H3,9,10);1H3,(H,3,4)
SMILES:c1cc2c(cc1C(=N)N)OCO2.CC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.