CymitQuimica logo

CAS 4722-94-5

:

4-chloropyridine-2,6-dicarboxylic acid

Description:
4-Chloropyridine-2,6-dicarboxylic acid is an organic compound characterized by its pyridine ring structure, which features two carboxylic acid groups (-COOH) at the 2 and 6 positions and a chlorine atom at the 4 position. This compound is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid groups. It exhibits acidic properties, with the ability to donate protons from its carboxylic acid functional groups. The presence of the chlorine atom can influence its reactivity and polarity, making it a useful intermediate in organic synthesis and pharmaceuticals. Additionally, 4-chloropyridine-2,6-dicarboxylic acid may participate in various chemical reactions, including esterification and amidation, and can serve as a building block for more complex molecules. Its unique structure allows for potential applications in agrochemicals, dyes, and other specialty chemicals. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H4ClNO4
InChI:InChI=1/C7H4ClNO4/c8-3-1-4(6(10)11)9-5(2-3)7(12)13/h1-2H,(H,10,11)(H,12,13)
InChI key:IYUMNONNHYADBU-UHFFFAOYSA-N
SMILES:c1c(cc(C(=O)O)nc1C(=O)O)Cl
Synonyms:
  • 2,6-Pyridinedicarboxylic Acid, 4-Chloro-
  • Acide 4-Chloropyridine-2,6-Dicarboxylique
  • 4-Chloro-2,6-pyridinedicarboxylicacid
  • 4-Chloropyridine-2,6-dicarboxylic acid
Found 5 products.