CAS 47230-38-6
:Diethyl biphenyl-4,4′-dicarboxylate
Description:
Diethyl biphenyl-4,4′-dicarboxylate, with the CAS number 47230-38-6, is an organic compound characterized by its biphenyl structure substituted with two ester functional groups. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its relatively low solubility in water but is soluble in organic solvents such as ethanol and ether. Diethyl biphenyl-4,4′-dicarboxylate is often utilized in organic synthesis and as an intermediate in the production of various chemical compounds. Its ester groups contribute to its reactivity, making it useful in esterification reactions and as a potential building block in the synthesis of polymers and pharmaceuticals. Additionally, it may exhibit moderate toxicity, necessitating appropriate handling and safety measures during use. Overall, this compound is significant in the field of organic chemistry for its versatile applications and reactivity.
Formula:C18H18O4
InChI:InChI=1/C18H18O4/c1-3-21-17(19)15-9-5-13(6-10-15)14-7-11-16(12-8-14)18(20)22-4-2/h5-12H,3-4H2,1-2H3
SMILES:CCOC(=O)c1ccc(cc1)c1ccc(cc1)C(=O)OCC
Synonyms:- 4,4-Biphenyldicarboxylic acid diethyl ester
- Diethyl biphenyl-4,4-dicarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Diethyl 4,4'-Biphenyldicarboxylate
CAS:Diethyl 4,4'-BiphenyldicarboxylateFormula:C18H18O4Purity:98%Molecular weight:298.33Diethyl [1,1'-biphenyl]-4,4'-dicarboxylate
CAS:Diethyl [1,1'-biphenyl]-4,4'-dicarboxylateFormula:C18H18O4Purity:98%Molecular weight:298.33Diethyl [1,1'-biphenyl]-4,4'-dicarboxylate
CAS:Formula:C18H18O4Purity:98%Color and Shape:SolidMolecular weight:298.3331Diethyl 4,4'-Biphenyldicarboxylate
CAS:Formula:C18H18O4Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:298.34Diethyl 4,4'-Biphenyldicarboxylate
CAS:Diethyl 4,4'-biphenyldicarboxylate is an organic compound that has a chiral center, making it optically active. It is an ester of biphenyl and dicarboxylic acid with the chemical formula CH2=C(CH3)2. The compound has been shown to be a model for other aromatic compounds with similar structures such as phenyl benzoate, which can also form crystals. Diethyl 4,4'-biphenyldicarboxylate is also a mesogen, which means it has liquid crystalline properties and can form thin films. The molecule's conformations are centrosymmetric and its crystal structure is spacer-type centrosymmetric.Formula:C18H18O4Purity:Min. 95%Molecular weight:298.33 g/mol





