CAS 47235-20-1
:3-(Benzylmethylamino)-1-(3-methyoxyphenyl)-2-methyl-propanone
Description:
3-(Benzylmethylamino)-1-(3-methoxyphenyl)-2-methyl-propanone, identified by its CAS number 47235-20-1, is a synthetic organic compound that belongs to the class of ketones. This substance features a complex molecular structure characterized by the presence of a ketone functional group, an aromatic benzyl moiety, and a methoxy-substituted phenyl group. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The compound may possess psychoactive properties, which has led to its investigation in various pharmacological studies. Its synthesis involves multi-step organic reactions, often requiring careful control of reaction conditions to ensure the desired purity and yield. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, this compound is of interest in medicinal chemistry and may have potential applications in drug development.
Formula:C19H23NO2
InChI:InChI=1S/C19H23NO2/c1-15(13-20(2)14-16-8-5-4-6-9-16)19(21)17-10-7-11-18(12-17)22-3/h4-12,15H,13-14H2,1-3H3
SMILES:CC(CN(C)Cc1ccccc1)C(=O)c1cccc(c1)OC
Synonyms:- 3-(Benzyl(methyl)amino)-1-(3-methoxyphenyl)-2-methylpropan-1-one
- 3-(benzylMethylaMino)-1-(3-Methyoxyphenyl)-2-Methyl-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(Benzyl(methyl)amino)-1-(3-methoxyphenyl)-2-methylpropan-1-one
CAS:Formula:C19H23NO2Molecular weight:297.3914

