CAS 473-29-0
:N,N-Dichlorobenzenesulfonamide
Description:
N,N-Dichlorobenzenesulfonamide is an organic compound characterized by its sulfonamide functional group and two chlorine atoms attached to a benzene ring. It typically appears as a white to off-white crystalline solid and is soluble in organic solvents but has limited solubility in water. The compound is known for its antibacterial properties and is often used in various applications, including pharmaceuticals and agricultural chemicals. Its structure consists of a benzene ring substituted with a sulfonamide group (–SO2NH2) and two chlorine atoms, which contribute to its reactivity and biological activity. N,N-Dichlorobenzenesulfonamide can undergo various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile intermediate in organic synthesis. Safety considerations are important when handling this compound, as it may pose health risks, including potential toxicity and environmental hazards. Proper safety protocols should be followed to mitigate exposure risks.
Formula:C6H5Cl2NO2S
InChI:InChI=1S/C6H5Cl2NO2S/c7-9(8)12(10,11)6-4-2-1-3-5-6/h1-5H
InChI key:InChIKey=PJBJJXCZRAHMCK-UHFFFAOYSA-N
SMILES:S(N(Cl)Cl)(=O)(=O)C1=CC=CC=C1
Synonyms:- Ai3-18057
- Benzenedichlorosulfamide
- Benzenesulfonamide, N,N-dichloro-
- Benzenesulfonic acid dichloroamide
- Dichloramine B
- Halogen H 1
- N,N-Dichlorobenzenesulfamide
- N,N-Dichlorobenzenesulfonamide
- Nsc 80504
- N,N-Dichlorobenzenesulphonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Dichloramine B
CAS:Formula:C6H5Cl2NO2SPurity:>95.0%(T)Color and Shape:White to Light yellow to Green powder to crystalMolecular weight:226.07N,N-Dichlorobenzenesulfonamide
CAS:N,N-DichlorobenzenesulfonamideFormula:C6H5Cl2NO2SPurity:95%Molecular weight:226.08Dichloramine B
CAS:Dichloramine BFormula:C6H5SO2NCl2Purity:95%Color and Shape:SolidMolecular weight:226.083Dichloramine B
CAS:Controlled ProductApplications Dichloramine B (cas# 473-29-0) is a useful research chemical.
E0Formula:C6H5Cl2NO2SColor and Shape:NeatMolecular weight:226.08N,N-Dichlorobenzenesulfonamide
CAS:N,N-Dichlorobenzenesulfonamide is a sulfonyl chloride that is used as an additive in the production of cellulose derivatives. It reacts with sodium salts to produce a number of sodium salts and acetylation products. The reaction proceeds through a two-step process: first, the chloroalkene reacts with sodium carbonate to form the corresponding sodium salt and an intermediate chloride; secondly, this intermediate chloride reacts with styrene to form N,N-dichlorobenzenesulfonamide. The chemical properties of N,N-dichlorobenzenesulfonamide have been examined by means of kinetic studies and structural analysis. This chemical has shown potential for use as a quaternary ammonium compound.Formula:C6H5Cl2NO2SPurity:Min. 95%Molecular weight:226.08 g/mol




