CAS 473-30-3
:Thiazolsulfone
Description:
Thiazolsulfone, with the CAS number 473-30-3, is a chemical compound characterized by its unique thiazole and sulfone functional groups. It typically appears as a crystalline solid and is known for its potential applications in pharmaceuticals and agrochemicals. The thiazole ring contributes to its heterocyclic nature, which can influence its reactivity and biological activity. Thiazolsulfone is often recognized for its antimicrobial properties, making it of interest in the development of antibacterial agents. Additionally, the sulfone group enhances its solubility in polar solvents, which can be advantageous for various chemical reactions and formulations. The compound's stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Safety data indicates that, like many chemical substances, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, thiazolsulfone is a compound of interest in both research and industrial applications due to its diverse chemical properties and potential utility.
Formula:C9H9N3O2S2
InChI:InChI=1S/C9H9N3O2S2/c10-6-1-3-7(4-2-6)16(13,14)8-5-12-9(11)15-8/h1-5H,10H2,(H2,11,12)
InChI key:InChIKey=KVEZIRCKNOTGKY-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC=C(N)C=C1)C=2SC(N)=NC2
Synonyms:- 2-Amino-5-(4-aminophenylsulfonyl)thiazole
- 2-Amino-5-(p-aminophenylsulfonyl)thiazole
- 2-Amino-5-sulfanilylthiazole
- 2-Thiazolamine, 5-((4-aminophenyl)sulfonyl)- (9CI)
- 2-Thiazolamine, 5-[(4-aminophenyl)sulfonyl]-
- 5-[(4-Aminophenyl)Sulfonyl]-1,3-Thiazol-2-Amine
- 5-[(4-Aminophenyl)sulfonyl]-2-thiazolamine
- Nsc 1884
- Promizol
- Promizole
- Protozol
- Thiazol sulfone
- Thiazole, 2-amino-5-sulfanilyl-
- Thiazole, 2-amino-5-sulfanilyl- (8CI)
- Thiazolesulfone
- Thiazolsulfone
- Thiazosulfonum
- Thiazosulfonum [INN-Latin]
- Tiazosolfone
- Tiazosolfone [DCIT]
- Tiazosulfona
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

