CAS 473-86-9
:3-Hydroxy-2-methylbutyric acid
Description:
3-Hydroxy-2-methylbutyric acid, also known as HMB (β-Hydroxy β-methylbutyric acid), is a branched-chain fatty acid derivative that is commonly associated with muscle metabolism and health. It is a colorless to pale yellow liquid at room temperature and is soluble in water, making it bioavailable for various biological applications. HMB is produced in small amounts in the body from the amino acid leucine and is known for its potential role in promoting muscle growth, reducing muscle breakdown, and aiding recovery after exercise. Its chemical structure features a hydroxyl group (-OH) and a methyl group (-CH3) attached to a butyric acid backbone, contributing to its unique properties. HMB is often used as a dietary supplement, particularly among athletes and bodybuilders, due to its purported benefits in enhancing strength and muscle mass. Additionally, it has been studied for its potential therapeutic effects in various conditions, including muscle wasting and certain chronic diseases. As with any supplement, it is important to consider dosage and consult with healthcare professionals before use.
Formula:C5H10O3
InChI:InChI=1S/C5H10O3/c1-3(4(2)6)5(7)8/h3-4,6H,1-2H3,(H,7,8)
InChI key:InChIKey=VEXDRERIMPLZLU-UHFFFAOYSA-N
SMILES:C(C(C)O)(C(O)=O)C
Synonyms:- 3-Hydroxy-2-Methylbutanoic Acid
- 3-Hydroxy-2-methylbutyric acid
- Butanoic acid, 3-hydroxy-2-methyl-
- Butyric acid, 3-hydroxy-2-methyl-
- Nilic acid
- α-Methyl-β-hydroxybutyric acid
- 2,3-Dimethyl-3-hydroxypropionic acid
- 2-Methyl-3-hydroxybutyric acid
- 3-Hydroxy-2-methylbutanoic Acid (2-Methyl-3-hydroxybutyric Acid)
- 3-hydroxy-2-methyl-Butanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Hydroxy-2-methyl-Butanoic acid
CAS:3-Hydroxy-2-methyl-Butanoic acidFormula:C5H10O3Purity:95%Molecular weight:118.133-Hydroxy-2-methyl-Butanoic acid
CAS:Formula:C5H10O3Purity:95%Color and Shape:LiquidMolecular weight:118.13113-Hydroxy-2-methylbutanoic Acid
CAS:Controlled ProductApplications 3-Hydroxy-2-methylbutanoic Acid (cas# 473-86-9) is a compound useful in organic synthesis.
Formula:C5H10O3Color and Shape:NeatMolecular weight:118.133-Hydroxy-2-methylbutanoic acid
CAS:3-Hydroxy-2-methylbutanoic acidFormula:C5H10O3Purity:95%Molecular weight:118.132-Methyl-3-hydroxybutyric acid
CAS:Please enquire for more information about 2-Methyl-3-hydroxybutyric acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C5H10O3Purity:Min. 95%Molecular weight:118.13 g/mol





