CAS 4733-68-0
:3,5-Dimethyl-2-pyridinecarboxylic acid
Description:
3,5-Dimethyl-2-pyridinecarboxylic acid, with the CAS number 4733-68-0, is an organic compound belonging to the class of pyridinecarboxylic acids. It features a pyridine ring substituted with two methyl groups at the 3 and 5 positions and a carboxylic acid group at the 2 position. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid functional group. Its molecular structure contributes to its acidic properties, making it a weak acid. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and utility as a building block in organic synthesis. Additionally, it may exhibit specific interactions with biological targets, which can be explored for medicinal chemistry applications. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c1-5-3-6(2)7(8(10)11)9-4-5/h3-4H,1-2H3,(H,10,11)
InChI key:InChIKey=CRQQOEOERUUJFO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)C=C(C)C=N1
Synonyms:- 2-Pyridinecarboxylic acid, 3,5-dimethyl-
- 3,5-Dimethyl-2-pyridinecarboxylic acid
- 3,5-Dimethylpicolinic acid
- 3,5-Lutidine-2-carboxylic acid
- Picolinic acid, 3,5-dimethyl-
- Picolinicacid, 3,5-dimethyl- (6CI,8CI)
- 3,5-Dimethylpyridine-2-carboxylic acid
- 5-diMethylpyridine-2-carboxylic acid
- 3,5-Dimethylpyridine-2-carboxylicaci
- 2-Pyridinecarboxylicacid,3,5-diMethyl-
- 3,5-Dimethylpicolinic acid, 2-Carboxy-3,5-dimethylpyridine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,5-Dimethylpyridine-2-carboxylic acid
CAS:3,5-Dimethylpyridine-2-carboxylic acidFormula:C8H9NO2Purity:95%Color and Shape:SolidMolecular weight:151.162552-Pyridinecarboxylicacid,3,5-dimethyl-(9CI)
CAS:Formula:C8H9NO2Purity:95%Color and Shape:SolidMolecular weight:151.16263,5-Dimethylpicolinic Acid
CAS:3,5-Dimethylpicolinic Acid is a synthetic compound that has shown antiulcer activity. This compound has been shown to inhibit the production of sulfate and nitrite, which are involved in the synthesis of gastric acid. 3,5-Dimethylpicolinic Acid also inhibits the release of hydrogen peroxide from cells and increases the synthesis of cGMP by inhibiting phosphodiesterase type IV. It may be used as an alternative to sodium nitrite for meat preservation.
Formula:C8H9NO2Purity:Min. 95%Molecular weight:151.16 g/mol



