CymitQuimica logo

CAS 47339-09-3

:

D-Galactopyranose,2,3,4,6-tetraacetate

Description:
D-Galactopyranose, 2,3,4,6-tetraacetate is a derivative of D-galactopyranose, a six-membered cyclic form of the sugar galactose. This compound is characterized by the presence of four acetyl groups attached to the hydroxyl groups at positions 2, 3, 4, and 6 of the galactopyranose ring. The acetylation enhances the lipophilicity of the molecule, which can influence its solubility and reactivity. D-Galactopyranose itself is a monosaccharide and an important component of various polysaccharides and glycoproteins. The tetraacetate form is often used in biochemical research and synthesis, particularly in studies involving carbohydrate chemistry and enzymatic reactions. Its structure allows for specific interactions with enzymes and receptors, making it a valuable compound in the study of carbohydrate metabolism and recognition. Additionally, the compound's stability and reactivity can be influenced by the presence of the acetyl groups, which can be hydrolyzed under certain conditions to regenerate the original sugar.
Formula:C14H20O10
InChI:InChI=1S/C14H20O10/c1-6(15)20-5-10-11(21-7(2)16)12(22-8(3)17)13(14(19)24-10)23-9(4)18/h10-14,19H,5H2,1-4H3/t10-,11+,12+,13-,14?/m1/s1
InChI key:IEOLRPPTIGNUNP-RRYROLNDSA-N
SMILES:CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H](C(O1)O)OC(=O)C)OC(=O)C)OC(=O)C
Synonyms:
  • Galactopyranose,tetraacetate (6CI)
  • 2,3,4,6-O-Tetraacetyl-D-galactose
  • 2,3,4,6-Tetra-O-Acetyl-D-Galactopyranose
Found 7 products.