CAS 47339-09-3
:D-Galactopyranose,2,3,4,6-tetraacetate
Description:
D-Galactopyranose, 2,3,4,6-tetraacetate is a derivative of D-galactopyranose, a six-membered cyclic form of the sugar galactose. This compound is characterized by the presence of four acetyl groups attached to the hydroxyl groups at positions 2, 3, 4, and 6 of the galactopyranose ring. The acetylation enhances the lipophilicity of the molecule, which can influence its solubility and reactivity. D-Galactopyranose itself is a monosaccharide and an important component of various polysaccharides and glycoproteins. The tetraacetate form is often used in biochemical research and synthesis, particularly in studies involving carbohydrate chemistry and enzymatic reactions. Its structure allows for specific interactions with enzymes and receptors, making it a valuable compound in the study of carbohydrate metabolism and recognition. Additionally, the compound's stability and reactivity can be influenced by the presence of the acetyl groups, which can be hydrolyzed under certain conditions to regenerate the original sugar.
Formula:C14H20O10
InChI:InChI=1S/C14H20O10/c1-6(15)20-5-10-11(21-7(2)16)12(22-8(3)17)13(14(19)24-10)23-9(4)18/h10-14,19H,5H2,1-4H3/t10-,11+,12+,13-,14?/m1/s1
InChI key:IEOLRPPTIGNUNP-RRYROLNDSA-N
SMILES:CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H](C(O1)O)OC(=O)C)OC(=O)C)OC(=O)C
Synonyms:- Galactopyranose,tetraacetate (6CI)
- 2,3,4,6-O-Tetraacetyl-D-galactose
- 2,3,4,6-Tetra-O-Acetyl-D-Galactopyranose
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(2R,3S,4S,5R)-2-(Acetoxymethyl)-6-hydroxytetrahydro-2H-pyran-3,4,5-triyl triacetate
CAS:(2R,3S,4S,5R)-2-(Acetoxymethyl)-6-hydroxytetrahydro-2H-pyran-3,4,5-triyl triacetateFormula:C14H20O10Purity:95+%Molecular weight:348.32,3,4,6-Tetra-O-acetyl-D-galactopyranose
CAS:2,3,4,6-Tetra-O-acetyl-D-galactopyranose is a biochemical reagent used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, glycan formation and degradation enzymology, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology.Formula:C14H20O10Molecular weight:348.3032,3,4,6-Tetra-O-acetyl-D-galactopyranose
CAS:(2R,3S,4S,5R)-2-(Acetoxymethyl)-6-hydroxytetrahydro-2H-pyran-3,4,5-triyl triacetateFormula:C14H20O10Purity:95+%Molecular weight:348.3(2R,3S,4S,5R)-2-(Acetoxymethyl)-6-hydroxytetrahydro-2H-pyran-3,4,5-triyl triacetate
CAS:Formula:C14H20O10Purity:98%Color and Shape:SolidMolecular weight:348.3042,3,4,6-Tetra-O-acetyl-D-galactopyranose
CAS:2,3,4,6-Tetra-O-acetyl-D-galactopyranose is a glycoside that has been used as an antigen in immunological studies and to study the role of fatty acids in cancer. This compound is phosphorylated to form 2,3,4,6-tetra-O-phospho-D-galactopyranose and reacts with primary alcohols to form transglycosylation products. 2,3,4,6-Tetra-O-acetylgalactopyranose also reacts with chloride ions to form disaccharides. As a result of these reactions 2,3,4,6-tetraacetylgalactopyranose has shown anticancer activity.Formula:C14H20O10Purity:Min. 95%Color and Shape:White PowderMolecular weight:348.3 g/mol






