CymitQuimica logo

CAS 473416-22-7

:

1H-Indazole-1-carboxylic acid, 3-bromo-5-nitro-, 1,1-dimethylethyl ester

Description:
1H-Indazole-1-carboxylic acid, 3-bromo-5-nitro-, 1,1-dimethylethyl ester, identified by CAS number 473416-22-7, is a chemical compound characterized by its indazole core structure, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features a carboxylic acid functional group that is esterified with a tert-butyl group, enhancing its lipophilicity and stability. The presence of bromine and nitro substituents at the 3 and 5 positions, respectively, introduces significant electronic effects, potentially influencing its reactivity and biological activity. The compound is likely to exhibit moderate solubility in organic solvents and may have limited solubility in water due to the bulky tert-butyl ester group. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where indazole derivatives are known for various biological activities. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols due to the presence of reactive functional groups.
Formula:C12H12BrN3O4
InChI:InChI=1S/C12H12BrN3O4/c1-12(2,3)20-11(17)15-9-5-4-7(16(18)19)6-8(9)10(13)14-15/h4-6H,1-3H3
InChI key:BWYOEKHPBGLTHI-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1C2=C(C=C(C=C2)[N+](=O)[O-])C(=N1)Br
Found 4 products.