CAS 4735-49-3
:1-[(E)-2-nitroethenyl]naphthalene
Description:
1-[(E)-2-nitroethenyl]naphthalene, with the CAS number 4735-49-3, is an organic compound characterized by its naphthalene backbone substituted with a nitroethenyl group. This compound typically exhibits a yellow to orange color due to the presence of the conjugated double bond system, which can also contribute to its electronic properties. It is likely to be a solid at room temperature, with moderate solubility in organic solvents such as ethanol and acetone, but limited solubility in water. The presence of the nitro group introduces polar characteristics, which can influence its reactivity and interactions with other chemical species. This compound may participate in various chemical reactions, including electrophilic substitutions and reductions, making it of interest in synthetic organic chemistry. Additionally, its structural features may impart interesting photophysical properties, potentially making it useful in applications such as dyes or sensors. Safety precautions should be observed when handling this compound, as nitro-substituted compounds can be hazardous.
Formula:C12H9NO2
InChI:InChI=1/C12H9NO2/c14-13(15)9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-9H/b9-8+
Synonyms:- 1-(2-Nitrovinyl)Naphthalene
- naphthalene, 1-[(E)-2-nitroethenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
