CAS 473567-59-8

3,5-Difluoro-L-phenylalanine methyl ester

Description:

3,5-Difluoro-L-phenylalanine methyl ester is a fluorinated derivative of the amino acid phenylalanine, characterized by the presence of two fluorine atoms at the 3 and 5 positions of the aromatic ring. This compound is typically used in biochemical research and pharmaceutical applications due to its potential role in modifying protein structures and functions. The methyl ester form enhances its solubility and bioavailability, making it suitable for various synthetic and analytical applications. The presence of fluorine atoms can influence the compound's electronic properties, stability, and interactions with biological systems. As a chiral molecule, it exists in two enantiomeric forms, with the L-isomer being biologically relevant. Its unique characteristics may also contribute to its utility in drug design and development, particularly in creating compounds with enhanced pharmacological properties. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₁₀H₁₁F₂NO₂

InChI: InChI=1S/C10H11F2NO2/c1-15-10(14)9(13)4-6-2-7(11)5-8(12)3-6/h2-3,5,9H,4,13H2,1H3/t9-/m0/s1

InChI key: InChIKey=NSKNSUFLKKGHKU-VIFPVBQESA-N

SMILES: C([C@@H](C(OC)=O)N)C1=CC(F)=CC(F)=C1

Synonyms:

• L-Phenylalanine, 3,5-difluoro-, methyl ester
• 3,5-Difluoro-L-phenylalanine methyl ester
• (S)-2-Amino-3-(3,5-difluorophenyl)propionic acid methyl ester

methyl (2S)-2-amino-3-(3,5-difluorophenyl)propanoate

CAS: 473567-59-8

Formula: C₁₀H₁₁F₂NO₂

Molecular weight: 215.1966

Ref: IN-DA00DFQ0