CAS 4737-50-2
:B-Pentylboronic acid
Description:
B-Pentylboronic acid, with the CAS number 4737-50-2, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pentyl chain. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, particularly in organic synthesis and medicinal chemistry. B-Pentylboronic acid is soluble in polar organic solvents, which enhances its utility in chemical reactions. Its reactivity is primarily attributed to the boron atom, which can participate in nucleophilic attacks and facilitate cross-coupling reactions, such as Suzuki-Miyaura coupling, to form carbon-carbon bonds. Additionally, the presence of the pentyl group can influence the compound's lipophilicity and biological activity. Safety precautions should be taken when handling this compound, as boronic acids can be irritants and may pose environmental hazards if not disposed of properly.
Formula:C5H13BO2
InChI:InChI=1S/C5H13BO2/c1-2-3-4-5-6(7)8/h7-8H,2-5H2,1H3
InChI key:InChIKey=ABWPXVJNCQKYDR-UHFFFAOYSA-N
SMILES:C(CCCC)B(O)O
Synonyms:- 1-Pentaneboronic acid
- B-Pentylboronic acid
- Boronic acid, B-pentyl-
- Boronic acid, pentyl-
- NSC 524968
- Pentylboronic Acid
- n-Pentylboronicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Pentylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C5H13BO2Purity:97.0 to 119.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:115.97Pentyldihydroxyborane
CAS:PentyldihydroxyboraneFormula:C5H13BO2Purity:98%Color and Shape:Solid-PowderMolecular weight:115.96652Pentylboronic Acid
CAS:Controlled ProductApplications N-Pentylboronic Acid is used in the synthesis of (-)-Δ8-THC and (-)-Δ9-THC. Also it aids in the synthesis of boronic acid inhibitors of endothelial lipase.
References O'Connell, D. et al.: Bioorg. Med. Chem. Lett., 22, 1397 (2012); Cheng, L. et al.: Org. Lett., 15, 764 (2013);Formula:C5H13BO2Color and Shape:NeatMolecular weight:115.97





