CAS 473732-87-5
:(αR)-α-Cyclopropyl-4-fluorobenzenemethanamine
Description:
(αR)-α-Cyclopropyl-4-fluorobenzenemethanamine, with the CAS number 473732-87-5, is a chemical compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring, attached to a benzene ring that has a fluorine substituent at the para position. This configuration contributes to its potential biological activity and interaction with various receptors. The amine functional group in the structure indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. The stereochemistry denoted by (αR) suggests that the compound has a specific spatial arrangement, which can significantly affect its pharmacological properties. Compounds like this are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders. Overall, the combination of the cyclopropyl moiety, fluorine atom, and amine group makes this compound an interesting subject for research in both synthetic and medicinal chemistry.
Formula:C10H12FN
InChI:InChI=1S/C10H12FN/c11-9-5-3-8(4-6-9)10(12)7-1-2-7/h3-7,10H,1-2,12H2/t10-/m1/s1
InChI key:InChIKey=DMSWDNXXNCUYLN-SNVBAGLBSA-N
SMILES:[C@@H](N)(C1CC1)C2=CC=C(F)C=C2
Synonyms:- (R)-Cyclopropyl(4-fluorophenyl)methanamine
- (αR)-α-Cyclopropyl-4-fluorobenzenemethanamine
- Benzenemethanamine, α-cyclopropyl-4-fluoro-, (αR)-
- ((R)-(Cyclopropyl)(4-fluorophenyl)methyl)amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
