CAS 473733-18-5
:(1R)-1-(3-Fluorophenyl)-2-methylpropylamine
Description:
(1R)-1-(3-Fluorophenyl)-2-methylpropylamine, with the CAS number 473733-18-5, is a chemical compound characterized by its chiral amine structure. It features a propylamine backbone with a methyl group and a 3-fluorophenyl substituent, which contributes to its unique properties. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity. This compound is typically studied in the context of medicinal chemistry and pharmacology, where its potential as a therapeutic agent is explored. Its chiral nature means that it can exist in two enantiomeric forms, which can exhibit different biological effects. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its interactions with biological targets are of interest, particularly in the development of drugs that may modulate neurotransmitter systems. Overall, (1R)-1-(3-Fluorophenyl)-2-methylpropylamine represents a significant subject of study in the field of organic and medicinal chemistry.
Formula:C10H14FN
InChI:InChI=1/C10H14FN/c1-7(2)10(12)8-4-3-5-9(11)6-8/h3-7,10H,12H2,1-2H3/t10-/m1/s1
SMILES:CC(C)[C@H](c1cccc(c1)F)N
Synonyms:- (1R)-1-(3-Fluorophenyl)-2-methyl-1-propanamine
- (1R)-1-(3-Fluorophenyl)-2-methylpropan-1-amine
- (1R)-1-(3-Fluorphenyl)-2-methylpropan-1-amin
- benzenemethanamine, 3-fluoro-α-(1-methylethyl)-, (alphaR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
