CymitQuimica logo

CAS 473923-97-6

:

3-Chloro-5-hydroxybenzonitrile

Description:
3-Chloro-5-hydroxybenzonitrile is an organic compound characterized by the presence of a chloro group, a hydroxyl group, and a nitrile functional group attached to a benzene ring. The molecular structure features a chlorine atom at the meta position relative to the hydroxyl group and a cyano group at the para position. This compound is typically a white to off-white solid and is soluble in polar organic solvents. Its hydroxyl group contributes to its potential as a hydrogen bond donor, while the nitrile group can participate in various chemical reactions, including nucleophilic additions. The presence of the chlorine atom can influence the compound's reactivity and stability, making it of interest in synthetic organic chemistry and pharmaceuticals. Additionally, the compound may exhibit biological activity, which could be explored in medicinal chemistry contexts. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H4ClNO
InChI:InChI=1S/C7H4ClNO/c8-6-1-5(4-9)2-7(10)3-6/h1-3,10H
InChI key:InChIKey=GHYUOOZZOMUNSY-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(Cl)=CC(O)=C1
Synonyms:
  • 3-Chloro-5-Hydroxy-Benzonitrile
  • 3-Chloro-5-cyanophenol
  • Benzonitrile, 3-Chloro-5-Hydroxy-
  • 3-Chloro-5-hydroxybenzonitrile
Found 5 products.