CymitQuimica logo

CAS 473924-59-3

:

3-Pyridinecarboxylic acid,5-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-

Description:
3-Pyridinecarboxylic acid, 5-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]- is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential for hydrogen bonding. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has a bulky protective group, which can influence its reactivity and solubility. The amino group attached to the carbon chain suggests that it may participate in various chemical reactions, including amide formation or nucleophilic substitutions. This compound is likely to be soluble in polar solvents due to the presence of the carboxylic acid and amino functionalities. Its unique structure may make it useful in pharmaceutical applications or as an intermediate in organic synthesis. Overall, the combination of functional groups and the aromatic nature of the pyridine ring contribute to its chemical behavior and potential applications in various fields.
Formula:C12H16N2O4
InChI:InChI=1S/C12H16N2O4/c1-12(2,3)18-11(17)14-6-8-4-9(10(15)16)7-13-5-8/h4-5,7H,6H2,1-3H3,(H,14,17)(H,15,16)
InChI key:YIYVEDNKIWXTCD-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NCC1=CC(=CN=C1)C(=O)O
Found 5 products.