CAS 474010-60-1
:1-Benzoyl-(R)-3-methylpiperazine hydrochloride
Description:
1-Benzoyl-(R)-3-methylpiperazine hydrochloride is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a benzoyl group attached to the nitrogen of the piperazine, contributing to its unique properties. The presence of the (R)-3-methyl configuration indicates a specific stereochemistry, which can influence its biological activity and interactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit various pharmacological activities, potentially acting as a ligand for certain receptors or enzymes. Its structural characteristics suggest it could be of interest in medicinal chemistry, particularly in the development of therapeutic agents. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, 1-Benzoyl-(R)-3-methylpiperazine hydrochloride represents a compound with specific structural features that may confer distinct biological properties.
Formula:C12H17ClN2O
InChI:InChI=1/C12H16N2O.ClH/c1-10-9-14(8-7-13-10)12(15)11-5-3-2-4-6-11;/h2-6,10,13H,7-9H2,1H3;1H/t10-;/m1./s1
SMILES:C[C@@H]1CN(CCN1)C(=O)c1ccccc1.Cl
Synonyms:- [(3R)-3-methylpiperazin-4-ium-1-yl]-phenyl-methanone chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(R)-(3-Methylpiperazin-1-yl)(phenyl)methanone hydrochloride
CAS:Formula:C12H17ClN2OMolecular weight:240.7292
