CymitQuimica logo

CAS 474056-47-8

:

N-[(1-methyl-1H-imidazol-2-yl)methyl]propan-2-amine

Description:
N-[(1-methyl-1H-imidazol-2-yl)methyl]propan-2-amine, with the CAS number 474056-47-8, is a chemical compound characterized by its unique structure that includes an imidazole ring and a propan-2-amine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of nitrogen atoms. The imidazole ring contributes to its potential biological activity, as imidazole derivatives are often found in various pharmaceuticals and biologically active compounds. The presence of the methyl group on the imidazole enhances its lipophilicity, which may influence its solubility and permeability in biological systems. Additionally, the propan-2-amine part of the molecule suggests that it may interact with neurotransmitter systems, making it of interest in medicinal chemistry. Overall, this compound's characteristics, including its molecular structure and functional groups, suggest potential applications in drug development and other chemical research areas.
Formula:C8H15N3
InChI:InChI=1/C8H15N3/c1-7(2)10-6-8-9-4-5-11(8)3/h4-5,7,10H,6H2,1-3H3
SMILES:CC(C)NCc1nccn1C
Synonyms:
  • 1H-Imidazole-2-methanamine, 1-methyl-N-(1-methylethyl)-
  • N-[(1-Methyl-1H-imidazol-2-yl)methyl]propan-2-amine
Found 2 products.