CAS 4744-50-7
:Furo[3,4-b]pyrazine-5,7-dione
Description:
Furo[3,4-b]pyrazine-5,7-dione, with the CAS number 4744-50-7, is a heterocyclic organic compound characterized by its fused pyrazine and furan rings. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, which contribute to its reactivity and potential applications in various chemical reactions. The structure of furo[3,4-b]pyrazine-5,7-dione includes a bicyclic framework that enhances its stability and may influence its electronic properties. It is typically a solid at room temperature and may exhibit solubility in polar organic solvents. The compound is of interest in medicinal chemistry and materials science due to its potential biological activities and utility in synthesizing other complex molecules. Its derivatives may possess various pharmacological properties, making it a subject of research in drug development. As with many heterocycles, the presence of nitrogen atoms in the pyrazine ring can also affect its interaction with biological targets, leading to diverse applications in pharmaceuticals and agrochemicals.
Formula:C6H2N2O3
InChI:InChI=1S/C6H2N2O3/c9-5-3-4(6(10)11-5)8-2-1-7-3/h1-2H
InChI key:InChIKey=AWJWCTOOIBYHON-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)O1)=NC=CN2
Synonyms:- 2,3-Pyrazinecarboxylic Anhydride
- 2,3-Pyrazinedicarboxlic Anhydride
- 2,3-Pyrazinedicarboxylic acid anhydride
- 2,3-Pyrazinedicarboxylicanhydrate
- Furo[3,4-B]Pyrazine-5,7-Dione
- Furo[3,4-b]pyrazine-5,7-dione (9CI)
- Pyrazine-2,3-Dicarboxylic Anhydride
- 2,3-PYRAZINEDICARBOXYLIC ANHYDRIDE
- Pyridene-2,3-dic arboxylic acid anhydride
- 2,3-Pyrazinedicarboxylic anhydride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Pyrazine-2,3-dicarboxylic acid anhydride
CAS:Pyrazine-2,3-dicarboxylic acid anhydrideFormula:C6H2N2O3Purity:98%Color and Shape:Off-white Solid-PowderMolecular weight:150.09168Furo[3,4-b]pyrazine-5,7-dione
CAS:Formula:C6H2N2O3Purity:98%Color and Shape:SolidMolecular weight:150.0917Furo[3,4-b]pyrazine-5,7-dione
CAS:Formula:C6H2N2O3Purity:97%Color and Shape:Solid, Off-white powderMolecular weight:150.093Furo[3,4-b]pyrazine-5,7-dione
CAS:Furo[3,4-b]pyrazine-5,7-dione is a chemical compound that belongs to the group of pyrazinoic acid derivatives. It has anti-inflammatory properties and is used as an ingredient in herbal products. Furo[3,4-b]pyrazine-5,7-dione shows a strong inhibitory effect on protease activity in vitro. This compound also inhibits tumor growth by modulating the expression of inflammatory cytokines such as IL1β, IL6, and TNFα. The molecular structure of Furo[3,4-b]pyrazine-5,7-dione can be accurately predicted using molecular modeling studies. In addition to its anti-inflammatory properties, furo[3,4-b]pyrazine-5,7-dione has been shown to be chemically stable at high temperatures and during chromatography.Formula:C6H2N2O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:150.09 g/mol




