CAS 474417-23-7
:tert-butyl 4-(1,3-thiazol-2-yl)piperazine-1-carboxylate
Description:
Tert-butyl 4-(1,3-thiazol-2-yl)piperazine-1-carboxylate is a chemical compound characterized by its unique structural features, which include a piperazine ring, a thiazole moiety, and a tert-butyl ester functional group. The presence of the thiazole ring contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and bioactive compounds. The tert-butyl group enhances the lipophilicity of the molecule, which can influence its solubility and permeability in biological systems. This compound may exhibit properties such as moderate to high stability under standard conditions, and its reactivity can be influenced by the functional groups present. Additionally, the piperazine ring can participate in hydrogen bonding and other interactions, making it a versatile scaffold in medicinal chemistry. Overall, tert-butyl 4-(1,3-thiazol-2-yl)piperazine-1-carboxylate is of interest for its potential applications in drug development and its role in various chemical reactions.
Formula:C12H19N3O2S
InChI:InChI=1/C12H19N3O2S/c1-12(2,3)17-11(16)15-7-5-14(6-8-15)10-13-4-9-18-10/h4,9H,5-8H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCN(CC1)c1nccs1
Synonyms:- 1-(2-Thiazolyl)-4-(tert-butoxycarbonyl)piperazine
- 474417-23-7
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
