CymitQuimica logo

CAS 4746-67-2

:

2,3-Dihydro-1H-benzimidazole

Description:
2,3-Dihydro-1H-benzimidazole is a bicyclic organic compound characterized by its fused benzene and imidazole rings. It features a five-membered imidazole ring that is partially saturated, contributing to its unique chemical properties. The compound is typically a colorless to pale yellow solid and is soluble in polar organic solvents. Its structure allows for potential hydrogen bonding due to the presence of nitrogen atoms, which can influence its reactivity and interactions with other molecules. 2,3-Dihydro-1H-benzimidazole is of interest in various fields, including medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The compound can participate in various chemical reactions, such as electrophilic substitutions and nucleophilic attacks, making it versatile in synthetic applications. Additionally, its derivatives may exhibit biological activity, which is a focus of ongoing research. Overall, 2,3-Dihydro-1H-benzimidazole is a significant compound in organic chemistry with potential applications in drug development and material science.
Formula:C7H8N2
InChI:InChI=1S/C7H8N2/c1-2-4-7-6(3-1)8-5-9-7/h1-4,8-9H,5H2
InChI key:InChIKey=MXMZCLLIUQEKSN-UHFFFAOYSA-N
SMILES:C1=2C(NCN1)=CC=CC2
Synonyms:
  • 2,3-Dihydro-1H-benzo[d]imidazole
  • 2,3-Dihydro-1H-benzimidazole
  • 2,3-Dihydro-1H-1,3-benzodiazole
  • Benzimidazoline
  • 1H-Benzimidazole, 2,3-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.