CymitQuimica logo

CAS 474625-95-1

:

1-[[4-(Acetylamino)phenyl]sulfonyl]-2-piperidinecarboxylic acid

Description:
1-[[4-(Acetylamino)phenyl]sulfonyl]-2-piperidinecarboxylic acid, identified by its CAS number 474625-95-1, is a chemical compound characterized by its complex structure, which includes a piperidine ring, an acetylamino group, and a sulfonyl moiety. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the piperidine nitrogen. It is likely to be soluble in polar solvents, reflecting its potential for hydrogen bonding. The sulfonyl group enhances its reactivity and may contribute to its biological activity, making it of interest in pharmaceutical research. The compound may also exhibit specific interactions with biological targets, which could be relevant for drug development. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the design of therapeutics targeting various diseases. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure levels.
Formula:C14H18N2O5S
InChI:InChI=1S/C14H18N2O5S/c1-10(17)15-11-5-7-12(8-6-11)22(20,21)16-9-3-2-4-13(16)14(18)19/h5-8,13H,2-4,9H2,1H3,(H,15,17)(H,18,19)
InChI key:InChIKey=BGVXSLAPWITTFG-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C(C(O)=O)CCCC1)C2=CC=C(NC(C)=O)C=C2
Synonyms:
  • 2-Piperidinecarboxylic acid, 1-[[4-(acetylamino)phenyl]sulfonyl]-
  • 1-[[4-(Acetylamino)phenyl]sulfonyl]-2-piperidinecarboxylic acid
Found 1 products.