CymitQuimica logo

CAS 474654-20-1

:

1-[(4-Chlorophenyl)phenylmethyl]-4-[(4-methylphenyl)sulfonyl]piperazine

Description:
1-[(4-Chlorophenyl)phenylmethyl]-4-[(4-methylphenyl)sulfonyl]piperazine, identified by its CAS number 474654-20-1, is a synthetic organic compound that belongs to the class of piperazine derivatives. This compound features a piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. The presence of a 4-chlorophenyl group and a 4-methylphenylsulfonyl group contributes to its unique chemical properties and potential biological activity. The sulfonyl group enhances the compound's solubility and reactivity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit various pharmacological effects, potentially acting as a receptor modulator or inhibitor, although specific biological activities would depend on further empirical studies. Its molecular structure suggests it could interact with biological targets, making it a candidate for research in therapeutic applications. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C24H25ClN2O2S
InChI:InChI=1S/C24H25ClN2O2S/c1-19-7-13-23(14-8-19)30(28,29)27-17-15-26(16-18-27)24(20-5-3-2-4-6-20)21-9-11-22(25)12-10-21/h2-14,24H,15-18H2,1H3
InChI key:InChIKey=JUQGYTLIFLVABO-UHFFFAOYSA-N
SMILES:C(N1CCN(S(=O)(=O)C2=CC=C(C)C=C2)CC1)(C3=CC=C(Cl)C=C3)C4=CC=CC=C4
Synonyms:
  • Piperazine, 1-[(4-chlorophenyl)phenylmethyl]-4-[(4-methylphenyl)sulfonyl]-
  • 1-[(4-Chlorophenyl)phenylmethyl]-4-[(4-methylphenyl)sulfonyl]piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.