CAS 474710-80-0
:6-bromoquinazoline-4-carboxylic acid
Description:
6-Bromoquinazoline-4-carboxylic acid is a heterocyclic organic compound characterized by its quinazoline core, which features a bromine substituent at the 6-position and a carboxylic acid group at the 4-position. This compound typically exhibits a crystalline solid form and is soluble in polar solvents, reflecting its functional groups. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various synthetic applications, particularly in medicinal chemistry for the development of pharmaceuticals. The carboxylic acid group contributes to its acidity and can participate in various chemical reactions, such as esterification or amidation. Additionally, the compound may exhibit biological activity, potentially acting as an inhibitor or modulator in specific biochemical pathways. Its structural features allow for potential interactions with biological targets, making it of interest in drug discovery and development. As with many heterocycles, the compound's properties can be influenced by the electronic effects of the substituents, which can affect its reactivity and interaction with other molecules.
Formula:C9H5BrN2O2
InChI:InChI=1/C9H5BrN2O2/c10-5-1-2-7-6(3-5)8(9(13)14)12-4-11-7/h1-4H,(H,13,14)
SMILES:c1cc2c(cc1Br)c(C(=O)O)ncn2
Synonyms:- 4-Quinazolinecarboxylic Acid, 6-Bromo-
- 6-Bromoquinazoline-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
