CAS 474711-89-2
:piperazine-1-carboxamide
Description:
Piperazine-1-carboxamide is a chemical compound characterized by its piperazine ring structure, which is a six-membered saturated heterocycle containing two nitrogen atoms. This compound features a carboxamide functional group, contributing to its polar nature and potential for hydrogen bonding. Piperazine-1-carboxamide is typically a white to off-white solid, and its solubility is influenced by the presence of the carboxamide group, allowing it to dissolve in polar solvents such as water and alcohols. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various conditions. Its molecular structure allows for potential interactions with biological targets, which can be explored in medicinal chemistry. Additionally, the presence of the piperazine moiety is often associated with a range of pharmacological properties, including anxiolytic and antidepressant effects. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.
Formula:C5H11N3O
InChI:InChI=1/C5H11N3O/c6-5(9)8-3-1-7-2-4-8/h7H,1-4H2,(H2,6,9)
SMILES:C1CN(CCN1)C(=N)O
Synonyms:- 1-Piperazinecarboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Piperazinecarboxamide Hydrochloride
CAS:Formula:C5H12ClN3OPurity:97%Color and Shape:SolidMolecular weight:165.6213Piperazine-1-carboxylic acid amide hydrochloride
CAS:Piperazine-1-carboxylic acid amide hydrochlorideFormula:C5H11N3O·ClHPurity:≥95%Color and Shape:SolidMolecular weight:165.62128Piperazine-1-carboxylic acid amide hydrochloride
CAS:Formula:C5H12ClN3OPurity:97%Color and Shape:SolidMolecular weight:165.62Piperazine-1-carboxylic acid amide hcl
CAS:Piperazine-1-carboxylic acid amide HCl, also known as D-allulose, is a versatile compound used in various research applications. It is commonly used in the synthesis of research chemicals such as Amprenavir and Dexrazoxane. Piperazine-1-carboxylic acid amide HCl has unique properties that make it suitable for different purposes. For example, it can be used as a monolaurate acetal or fatty acid derivative, providing a wide range of possibilities for researchers.Formula:C5H12ClN3OPurity:Min. 95%Molecular weight:165.62 g/mol



