CAS 4754-39-6

5′-Deoxyadenosine

Description:

5′-Deoxyadenosine, also known as deoxyadenosine, is a nucleoside that consists of the purine base adenine attached to a deoxyribose sugar. It plays a crucial role in various biochemical processes, particularly in the synthesis of DNA, where it serves as a building block. The chemical formula of 5′-deoxyadenosine is C10H13N5O3, and it has a molecular weight that reflects its structure. This compound is characterized by its ability to participate in phosphorylation reactions, leading to the formation of deoxyadenosine triphosphate (dATP), an essential energy carrier and substrate for DNA polymerases during DNA replication. Additionally, 5′-deoxyadenosine can be involved in cellular signaling pathways and is a precursor for the synthesis of other important biomolecules. Its CAS number, 4754-39-6, is used for identification in chemical databases. In terms of solubility, it is generally soluble in water, making it accessible for various laboratory applications. Overall, 5′-deoxyadenosine is a vital component in molecular biology and biochemistry.

Formula: C₁₀H₁₃N₅O₃

InChI: InChI=1S/C10H13N5O3/c1-4-6(16)7(17)10(18-4)15-3-14-5-8(11)12-2-13-9(5)15/h2-4,6-7,10,16-17H,1H3,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1

InChI key: InChIKey=XGYIMTFOTBMPFP-KQYNXXCUSA-N

SMILES: O[C@H]1[C@H](N2C=3C(N=C2)=C(N)N=CN3)O[C@H](C)[C@H]1O

Synonyms:

• 2-(6-amino-9H-purin-9-yl)-5-methyltetrahydrofuran-3,4-diol
• 5'-Deoxyadenosine
• 9-(5-deoxypentofuranosyl)-9H-purin-6-amine
• Adenosine, 5′-deoxy-

Adenosine, 5'-deoxy-

CAS: 4754-39-6

Formula: C₁₀H₁₃N₅O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 251.2419

Ref: IN-DA00700D

5'-DEOXYADENOSINE

CAS: 4754-39-6

5'-DEOXYADENOSINE

Purity: ≥95%

Molecular weight: 251.24g/mol

Ref: 54-BUP06203

5''-Deoxyadenosine

CAS: 4754-39-6

Formula: C₁₀H₁₃N₅O₃

Purity: (HPLC) ≥ 98.0%

Color and Shape: White powder

Molecular weight: 251.24

Ref: 7W-GN2017

5'-DEOXYADENOSINE

CAS: 4754-39-6

5'-Deoxyadenosine (5′-dAdo) is an oxidized nucleoside found in the urine of normal subjects.

Formula: C₁₀H₁₃N₅O₃

Purity: 97.35%

Color and Shape: Solid

Molecular weight: 251.24

Ref: TM-T4971

5'-Deoxyadenosine

CAS: 4754-39-6

5'-Deoxyadenosine is a nucleoside that is produced by the enzymatic reaction of glycolaldehyde and ATP. It is found in both DNA and RNA, where it plays an important role in the catalytic subunit of ribonucleotide reductase. 5'-Deoxyadenosine has been shown to be involved in hydrogen bonding with other molecules, such as ethanolamine. It also has a kinetic effect on the enzyme activity of ribonucleotide reductase by forming intramolecular hydrogen bonds with other adenine nucleotides. The analogs of 5'-deoxyadenosine have been shown to inhibit viral replication in cell culture studies using typhimurium virus.

Formula: C₁₀H₁₃N₅O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 251.25 g/mol

Ref: 3D-ND02599

Adenosine, 5′-deoxy-

CAS: 4754-39-6

Purity: ≥98%

Molecular weight: 251.2460022

Ref: 10-F866331

5'-Deoxyadenosine

Controlled Product

CAS: 4754-39-6

Formula: C₁₀H₁₃N₅O₃

Color and Shape: Neat

Molecular weight: 251.242

Ref: TR-D232155