CAS 4754-39-6
:5′-Deoxyadenosine
Description:
5′-Deoxyadenosine, also known as deoxyadenosine, is a nucleoside that consists of the purine base adenine attached to a deoxyribose sugar. It plays a crucial role in various biochemical processes, particularly in the synthesis of DNA, where it serves as a building block. The chemical formula of 5′-deoxyadenosine is C10H13N5O3, and it has a molecular weight that reflects its structure. This compound is characterized by its ability to participate in phosphorylation reactions, leading to the formation of deoxyadenosine triphosphate (dATP), an essential energy carrier and substrate for DNA polymerases during DNA replication. Additionally, 5′-deoxyadenosine can be involved in cellular signaling pathways and is a precursor for the synthesis of other important biomolecules. Its CAS number, 4754-39-6, is used for identification in chemical databases. In terms of solubility, it is generally soluble in water, making it accessible for various laboratory applications. Overall, 5′-deoxyadenosine is a vital component in molecular biology and biochemistry.
Formula:C10H13N5O3
InChI:InChI=1S/C10H13N5O3/c1-4-6(16)7(17)10(18-4)15-3-14-5-8(11)12-2-13-9(5)15/h2-4,6-7,10,16-17H,1H3,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1
InChI key:InChIKey=XGYIMTFOTBMPFP-KQYNXXCUSA-N
SMILES:O[C@H]1[C@H](N2C=3C(N=C2)=C(N)N=CN3)O[C@H](C)[C@H]1O
Synonyms:- 2-(6-amino-9H-purin-9-yl)-5-methyltetrahydrofuran-3,4-diol
- 5'-Deoxyadenosine
- 9-(5-deoxypentofuranosyl)-9H-purin-6-amine
- Adenosine, 5′-deoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
5'-Deoxyadenosine
CAS:(2R,3R,4S,5R)-2-(6-Amino-9H-purin-9-yl)-5-methyltetrahydrofuran-3,4-diolFormula:C10H13N5O3Purity:98%Molecular weight:251.245''-Deoxyadenosine
CAS:Formula:C10H13N5O3Purity:(HPLC) ≥ 98.0%Color and Shape:White powderMolecular weight:251.245'-DEOXYADENOSINE
CAS:5'-Deoxyadenosine (5′-dAdo) is an oxidized nucleoside found in the urine of normal subjects.Formula:C10H13N5O3Purity:97.35%Color and Shape:SolidMolecular weight:251.245'-Deoxyadenosine
CAS:5'-Deoxyadenosine is a nucleoside that is produced by the enzymatic reaction of glycolaldehyde and ATP. It is found in both DNA and RNA, where it plays an important role in the catalytic subunit of ribonucleotide reductase. 5'-Deoxyadenosine has been shown to be involved in hydrogen bonding with other molecules, such as ethanolamine. It also has a kinetic effect on the enzyme activity of ribonucleotide reductase by forming intramolecular hydrogen bonds with other adenine nucleotides. The analogs of 5'-deoxyadenosine have been shown to inhibit viral replication in cell culture studies using typhimurium virus.Formula:C10H13N5O3Purity:Min. 95%Color and Shape:PowderMolecular weight:251.25 g/mol5'-Deoxyadenosine
CAS:Controlled ProductFormula:C10H13N5O3Color and Shape:NeatMolecular weight:251.242







